C9H9FN4S — CID 105181850
1-(3-fluoro-4-pyridinyl)-N-methyl-1-(thiadiazol-4-yl)methanamine (PubChem CID 105181850) has the molecular formula C9H9FN4S and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-(3-fluoro-4-pyridinyl)-N-methyl-1-(thiadiazol-4-yl)methanamine.
| Compound Name | 1-(3-fluoro-4-pyridinyl)-N-methyl-1-(thiadiazol-4-yl)methanamine |
|---|---|
| PubChem CID | 105181850 |
| Molecular Formula | C9H9FN4S |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 1-(3-fluoro-4-pyridinyl)-N-methyl-1-(thiadiazol-4-yl)methanamine |
| SMILES | CNC(c1csnn1)c1ccncc1F |
| InChI | InChI=1S/C9H9FN4S/c1-11-9(8-5-15-14-13-8)6-2-3-12-4-7(6)10/h2-5,9,11H,1H3 |
| InChIKey | FRSCMCBJGUUVRU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |