C10H11FN4S — CID 105181971
N-[(3-fluoro-4-pyridinyl)-(thiadiazol-4-yl)methyl]ethanamine (PubChem CID 105181971) has the molecular formula C10H11FN4S and a molecular weight of 238.29 g/mol. Its IUPAC name is N-[(3-fluoro-4-pyridinyl)-(thiadiazol-4-yl)methyl]ethanamine.
| Compound Name | N-[(3-fluoro-4-pyridinyl)-(thiadiazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 105181971 |
| Molecular Formula | C10H11FN4S |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | N-[(3-fluoro-4-pyridinyl)-(thiadiazol-4-yl)methyl]ethanamine |
| SMILES | CCNC(c1csnn1)c1ccncc1F |
| InChI | InChI=1S/C10H11FN4S/c1-2-13-10(9-6-16-15-14-9)7-3-4-12-5-8(7)11/h3-6,10,13H,2H2,1H3 |
| InChIKey | MCHXDJGIRPVZAQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |