C17H15N3O5S — CID 10474485
benzyl N-(4-imidazol-1-ylphenoxy)sulfonylcarbamate (PubChem CID 10474485) has the molecular formula C17H15N3O5S and a molecular weight of 373.39 g/mol. Its IUPAC name is benzyl N-(4-imidazol-1-ylphenoxy)sulfonylcarbamate.
| Compound Name | benzyl N-(4-imidazol-1-ylphenoxy)sulfonylcarbamate |
|---|---|
| PubChem CID | 10474485 |
| Molecular Formula | C17H15N3O5S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | benzyl N-(4-imidazol-1-ylphenoxy)sulfonylcarbamate |
| SMILES | O=C(NS(=O)(=O)Oc1ccc(-n2ccnc2)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C17H15N3O5S/c21-17(24-12-14-4-2-1-3-5-14)19-26(22,23)25-16-8-6-15(7-9-16)20-11-10-18-13-20/h1-11,13H,12H2,(H,19,21) |
| InChIKey | BQYNUNRTZRJOKI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |