C21H36O4Si — CID 10474927
ethyl (1S,2S,4aR,6S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-formyl-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylate (PubChem CID 10474927) has the molecular formula C21H36O4Si and a molecular weight of 380.60 g/mol. Its IUPAC name is ethyl (1S,2S,4aR,6S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-formyl-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylate.
| Compound Name | ethyl (1S,2S,4aR,6S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-formyl-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 10474927 |
| Molecular Formula | C21H36O4Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | ethyl (1S,2S,4aR,6S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-formyl-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](C=O)C[C@@H]2C=C[C@@H]1C |
| InChI | InChI=1S/C21H36O4Si/c1-8-24-20(23)18-14(2)9-10-16-11-15(13-22)12-17(19(16)18)25-26(6,7)21(3,4)5/h9-10,13-19H,8,11-12H2,1-7H3/t14-,15-,16-,17-,18-,19+/m0/s1 |
| InChIKey | DGIQDCDTTYLNJZ-KOUJMVCDSA-N |
| XLogP | 4.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|