C18H17Cl2NO4 — CID 10474982
6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxamide (PubChem CID 10474982) has the molecular formula C18H17Cl2NO4 and a molecular weight of 382.24 g/mol. Its IUPAC name is 6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxamide.
| Compound Name | 6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxamide |
|---|---|
| PubChem CID | 10474982 |
| Molecular Formula | C18H17Cl2NO4 |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxamide |
| SMILES | CC1(O)OOC(c2ccc(Cl)cc2)(c2ccc(Cl)cc2)CC1C(N)=O |
| InChI | InChI=1S/C18H17Cl2NO4/c1-17(23)15(16(21)22)10-18(25-24-17,11-2-6-13(19)7-3-11)12-4-8-14(20)9-5-12/h2-9,15,23H,10H2,1H3,(H2,21,22) |
| InChIKey | ICSKXQWLBXKXGN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|