C12H12F2O4S — CID 104756136
2-(2,5-difluorophenyl)sulfonyl-1-(oxolan-3-yl)ethanone (PubChem CID 104756136) has the molecular formula C12H12F2O4S and a molecular weight of 290.29 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)sulfonyl-1-(oxolan-3-yl)ethanone.
| Compound Name | 2-(2,5-difluorophenyl)sulfonyl-1-(oxolan-3-yl)ethanone |
|---|---|
| PubChem CID | 104756136 |
| Molecular Formula | C12H12F2O4S |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 2-(2,5-difluorophenyl)sulfonyl-1-(oxolan-3-yl)ethanone |
| SMILES | O=C(CS(=O)(=O)c1cc(F)ccc1F)C1CCOC1 |
| InChI | InChI=1S/C12H12F2O4S/c13-9-1-2-10(14)12(5-9)19(16,17)7-11(15)8-3-4-18-6-8/h1-2,5,8H,3-4,6-7H2 |
| InChIKey | JJYDNZBRGZFMLC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |