C12H13FO4S — CID 104756330
2-(3-fluorophenyl)sulfonyl-1-(oxolan-3-yl)ethanone (PubChem CID 104756330) has the molecular formula C12H13FO4S and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-(3-fluorophenyl)sulfonyl-1-(oxolan-3-yl)ethanone.
| Compound Name | 2-(3-fluorophenyl)sulfonyl-1-(oxolan-3-yl)ethanone |
|---|---|
| PubChem CID | 104756330 |
| Molecular Formula | C12H13FO4S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 2-(3-fluorophenyl)sulfonyl-1-(oxolan-3-yl)ethanone |
| SMILES | O=C(CS(=O)(=O)c1cccc(F)c1)C1CCOC1 |
| InChI | InChI=1S/C12H13FO4S/c13-10-2-1-3-11(6-10)18(15,16)8-12(14)9-4-5-17-7-9/h1-3,6,9H,4-5,7-8H2 |
| InChIKey | MBQLDHKSQXNAJP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |