C11H9ClN4O3S — CID 104757678
5-chloro-N-(2,4-dimethyl-5-nitrophenyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 104757678) has the molecular formula C11H9ClN4O3S and a molecular weight of 312.74 g/mol. Its IUPAC name is 5-chloro-N-(2,4-dimethyl-5-nitrophenyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-chloro-N-(2,4-dimethyl-5-nitrophenyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 104757678 |
| Molecular Formula | C11H9ClN4O3S |
| Molecular Weight | 312.74 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 5-chloro-N-(2,4-dimethyl-5-nitrophenyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | Cc1cc(C)c([N+](=O)[O-])cc1NC(=O)c1nnc(Cl)s1 |
| InChI | InChI=1S/C11H9ClN4O3S/c1-5-3-6(2)8(16(18)19)4-7(5)13-9(17)10-14-15-11(12)20-10/h3-4H,1-2H3,(H,13,17) |
| InChIKey | PLYCYGAVZUWVSA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.74 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|