C12H13ClN4OS — CID 80625694
5-chloro-N-[4-(dimethylamino)-2-methylphenyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80625694) has the molecular formula C12H13ClN4OS and a molecular weight of 296.78 g/mol. Its IUPAC name is 5-chloro-N-[4-(dimethylamino)-2-methylphenyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-chloro-N-[4-(dimethylamino)-2-methylphenyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80625694 |
| Molecular Formula | C12H13ClN4OS |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 5-chloro-N-[4-(dimethylamino)-2-methylphenyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | Cc1cc(N(C)C)ccc1NC(=O)c1nnc(Cl)s1 |
| InChI | InChI=1S/C12H13ClN4OS/c1-7-6-8(17(2)3)4-5-9(7)14-10(18)11-15-16-12(13)19-11/h4-6H,1-3H3,(H,14,18) |
| InChIKey | OYSQSURNDIUWTN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|