C10H7ClIN3OS — CID 80625362
5-chloro-N-(4-iodo-2-methylphenyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80625362) has the molecular formula C10H7ClIN3OS and a molecular weight of 379.61 g/mol. Its IUPAC name is 5-chloro-N-(4-iodo-2-methylphenyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-chloro-N-(4-iodo-2-methylphenyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80625362 |
| Molecular Formula | C10H7ClIN3OS |
| Molecular Weight | 379.61 g/mol |
| Exact Mass | 378.90 |
| IUPAC Name | 5-chloro-N-(4-iodo-2-methylphenyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | Cc1cc(I)ccc1NC(=O)c1nnc(Cl)s1 |
| InChI | InChI=1S/C10H7ClIN3OS/c1-5-4-6(12)2-3-7(5)13-8(16)9-14-15-10(11)17-9/h2-4H,1H3,(H,13,16) |
| InChIKey | AWFCYTNYSAONTG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.61 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|