C13H16FN5O2 — CID 104765235
2-fluoro-5-[1-[(3-methoxyoxolan-3-yl)methyl]tetrazol-5-yl]aniline (PubChem CID 104765235) has the molecular formula C13H16FN5O2 and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-fluoro-5-[1-[(3-methoxyoxolan-3-yl)methyl]tetrazol-5-yl]aniline.
| Compound Name | 2-fluoro-5-[1-[(3-methoxyoxolan-3-yl)methyl]tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 104765235 |
| Molecular Formula | C13H16FN5O2 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-fluoro-5-[1-[(3-methoxyoxolan-3-yl)methyl]tetrazol-5-yl]aniline |
| SMILES | COC1(Cn2nnnc2-c2ccc(F)c(N)c2)CCOC1 |
| InChI | InChI=1S/C13H16FN5O2/c1-20-13(4-5-21-8-13)7-19-12(16-17-18-19)9-2-3-10(14)11(15)6-9/h2-3,6H,4-5,7-8,15H2,1H3 |
| InChIKey | MUYPDYHOBRTTIU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|