C16H16BrNOS — CID 104768656
4-bromo-2-(3,4-dihydro-2H-chromen-4-ylmethylsulfanyl)aniline (PubChem CID 104768656) has the molecular formula C16H16BrNOS and a molecular weight of 350.28 g/mol. Its IUPAC name is 4-bromo-2-(3,4-dihydro-2H-chromen-4-ylmethylsulfanyl)aniline.
| Compound Name | 4-bromo-2-(3,4-dihydro-2H-chromen-4-ylmethylsulfanyl)aniline |
|---|---|
| PubChem CID | 104768656 |
| Molecular Formula | C16H16BrNOS |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 4-bromo-2-(3,4-dihydro-2H-chromen-4-ylmethylsulfanyl)aniline |
| SMILES | Nc1ccc(Br)cc1SCC1CCOc2ccccc21 |
| InChI | InChI=1S/C16H16BrNOS/c17-12-5-6-14(18)16(9-12)20-10-11-7-8-19-15-4-2-1-3-13(11)15/h1-6,9,11H,7-8,10,18H2 |
| InChIKey | KXPLKSXGOGWVBI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|