C17H18BrNS — CID 79532990
4-bromo-2-(1,2,3,4-tetrahydronaphthalen-1-ylmethylsulfanyl)aniline (PubChem CID 79532990) has the molecular formula C17H18BrNS and a molecular weight of 348.31 g/mol. Its IUPAC name is 4-bromo-2-(1,2,3,4-tetrahydronaphthalen-1-ylmethylsulfanyl)aniline.
| Compound Name | 4-bromo-2-(1,2,3,4-tetrahydronaphthalen-1-ylmethylsulfanyl)aniline |
|---|---|
| PubChem CID | 79532990 |
| Molecular Formula | C17H18BrNS |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 4-bromo-2-(1,2,3,4-tetrahydronaphthalen-1-ylmethylsulfanyl)aniline |
| SMILES | Nc1ccc(Br)cc1SCC1CCCc2ccccc21 |
| InChI | InChI=1S/C17H18BrNS/c18-14-8-9-16(19)17(10-14)20-11-13-6-3-5-12-4-1-2-7-15(12)13/h1-2,4,7-10,13H,3,5-6,11,19H2 |
| InChIKey | LZHKSYNDLYNWKB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|