C18H21NS — CID 63773145
5-methyl-2-(1,2,3,4-tetrahydronaphthalen-1-ylmethylsulfanyl)aniline (PubChem CID 63773145) has the molecular formula C18H21NS and a molecular weight of 283.44 g/mol. Its IUPAC name is 5-methyl-2-(1,2,3,4-tetrahydronaphthalen-1-ylmethylsulfanyl)aniline.
| Compound Name | 5-methyl-2-(1,2,3,4-tetrahydronaphthalen-1-ylmethylsulfanyl)aniline |
|---|---|
| PubChem CID | 63773145 |
| Molecular Formula | C18H21NS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 5-methyl-2-(1,2,3,4-tetrahydronaphthalen-1-ylmethylsulfanyl)aniline |
| SMILES | Cc1ccc(SCC2CCCc3ccccc32)c(N)c1 |
| InChI | InChI=1S/C18H21NS/c1-13-9-10-18(17(19)11-13)20-12-15-7-4-6-14-5-2-3-8-16(14)15/h2-3,5,8-11,15H,4,6-7,12,19H2,1H3 |
| InChIKey | HMLTUCNKUUCOHT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|