About 2-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrazol-3-amine
2-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrazol-3-amine (PubChem CID 104770174) has the molecular formula C8H10N4S
and a molecular weight of 194.26 g/mol. Its IUPAC name is 2-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrazol-3-amine.
Analyze 2-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrazol-3-amine?
The IUPAC name of 2-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrazol-3-amine (CID 104770174) is 2-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrazol-3-amine.
What is the SMILES notation for 2-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrazol-3-amine?
The canonical SMILES for 2-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrazol-3-amine is Cc1csc(Cn2nccc2N)n1.
What is the InChIKey of 2-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrazol-3-amine?
The InChIKey is GDFZUUYLLKKVOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4S/c1-6-5-13-8(11-6)4-12-7(9)2-3-10-12/h2-3,5H,4,9H2,1H3.
What are the key properties of 2-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrazol-3-amine?
2-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrazol-3-amine has a molecular weight of 194.26 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrazol-3-amine is sourced from PubChem (CID 104770174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).