C9H12N4S — CID 106571781
1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]imidazol-2-amine (PubChem CID 106571781) has the molecular formula C9H12N4S and a molecular weight of 208.29 g/mol. Its IUPAC name is 1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]imidazol-2-amine.
| Compound Name | 1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]imidazol-2-amine |
|---|---|
| PubChem CID | 106571781 |
| Molecular Formula | C9H12N4S |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]imidazol-2-amine |
| SMILES | Cc1csc(CCn2ccnc2N)n1 |
| InChI | InChI=1S/C9H12N4S/c1-7-6-14-8(12-7)2-4-13-5-3-11-9(13)10/h3,5-6H,2,4H2,1H3,(H2,10,11) |
| InChIKey | WQMYMVRDDPVWCN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |