C10H13N3O2S — CID 64955773
1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione (PubChem CID 64955773) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione.
| Compound Name | 1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 64955773 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 1-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione |
| SMILES | Cc1csc(CCN2CC(=O)NCC2=O)n1 |
| InChI | InChI=1S/C10H13N3O2S/c1-7-6-16-9(12-7)2-3-13-5-8(14)11-4-10(13)15/h6H,2-5H2,1H3,(H,11,14) |
| InChIKey | MBMBUMWCAOLZHQ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |