C19H28O2 — CID 104770871
2-(3,4-dihydro-2H-chromen-4-ylmethyl)-4-propylcyclohexan-1-ol (PubChem CID 104770871) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-4-ylmethyl)-4-propylcyclohexan-1-ol.
| Compound Name | 2-(3,4-dihydro-2H-chromen-4-ylmethyl)-4-propylcyclohexan-1-ol |
|---|---|
| PubChem CID | 104770871 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-4-ylmethyl)-4-propylcyclohexan-1-ol |
| SMILES | CCCC1CCC(O)C(CC2CCOc3ccccc32)C1 |
| InChI | InChI=1S/C19H28O2/c1-2-5-14-8-9-18(20)16(12-14)13-15-10-11-21-19-7-4-3-6-17(15)19/h3-4,6-7,14-16,18,20H,2,5,8-13H2,1H3 |
| InChIKey | WWKRWTNNZQUXRT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |