C19H29NO — CID 104771127
2-(3,4-dihydro-2H-chromen-4-ylmethyl)-N-propylcyclohexan-1-amine (PubChem CID 104771127) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-4-ylmethyl)-N-propylcyclohexan-1-amine.
| Compound Name | 2-(3,4-dihydro-2H-chromen-4-ylmethyl)-N-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 104771127 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-4-ylmethyl)-N-propylcyclohexan-1-amine |
| SMILES | CCCNC1CCCCC1CC1CCOc2ccccc21 |
| InChI | InChI=1S/C19H29NO/c1-2-12-20-18-9-5-3-7-16(18)14-15-11-13-21-19-10-6-4-8-17(15)19/h4,6,8,10,15-16,18,20H,2-3,5,7,9,11-14H2,1H3 |
| InChIKey | PLBDZSTVGOSOJA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |