C10H12N4S — CID 104771355
N-ethyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine (PubChem CID 104771355) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is N-ethyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine.
| Compound Name | N-ethyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 104771355 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | N-ethyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine |
| SMILES | CCNc1ccnc(-c2nc(C)cs2)n1 |
| InChI | InChI=1S/C10H12N4S/c1-3-11-8-4-5-12-9(14-8)10-13-7(2)6-15-10/h4-6H,3H2,1-2H3,(H,11,12,14) |
| InChIKey | JHPKJPSOQFFTCI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |