C15H22N2O2S — CID 104773704
5-(4-methylpiperidin-1-yl)sulfonyl-1,2,3,4-tetrahydroquinoline (PubChem CID 104773704) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is 5-(4-methylpiperidin-1-yl)sulfonyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 5-(4-methylpiperidin-1-yl)sulfonyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 104773704 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 5-(4-methylpiperidin-1-yl)sulfonyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CC1CCN(S(=O)(=O)c2cccc3c2CCCN3)CC1 |
| InChI | InChI=1S/C15H22N2O2S/c1-12-7-10-17(11-8-12)20(18,19)15-6-2-5-14-13(15)4-3-9-16-14/h2,5-6,12,16H,3-4,7-11H2,1H3 |
| InChIKey | IXHMQJJTDWHRHJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |