C14H21N3O2S — CID 104773713
5-(4-methylpiperazin-1-yl)sulfonyl-1,2,3,4-tetrahydroquinoline (PubChem CID 104773713) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 5-(4-methylpiperazin-1-yl)sulfonyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 5-(4-methylpiperazin-1-yl)sulfonyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 104773713 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 5-(4-methylpiperazin-1-yl)sulfonyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CN1CCN(S(=O)(=O)c2cccc3c2CCCN3)CC1 |
| InChI | InChI=1S/C14H21N3O2S/c1-16-8-10-17(11-9-16)20(18,19)14-6-2-5-13-12(14)4-3-7-15-13/h2,5-6,15H,3-4,7-11H2,1H3 |
| InChIKey | RRPAENKLNUFAHK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |