C12H14N4O3S — CID 104774115
N'-hydroxy-2-[methyl(quinolin-5-ylsulfonyl)amino]ethanimidamide (PubChem CID 104774115) has the molecular formula C12H14N4O3S and a molecular weight of 294.34 g/mol. Its IUPAC name is N'-hydroxy-2-[methyl(quinolin-5-ylsulfonyl)amino]ethanimidamide.
| Compound Name | N'-hydroxy-2-[methyl(quinolin-5-ylsulfonyl)amino]ethanimidamide |
|---|---|
| PubChem CID | 104774115 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | N'-hydroxy-2-[methyl(quinolin-5-ylsulfonyl)amino]ethanimidamide |
| SMILES | CN(C/C(N)=N/O)S(=O)(=O)c1cccc2ncccc12 |
| InChI | InChI=1S/C12H14N4O3S/c1-16(8-12(13)15-17)20(18,19)11-6-2-5-10-9(11)4-3-7-14-10/h2-7,17H,8H2,1H3,(H2,13,15) |
| InChIKey | ZNQAKGOZGQLCQP-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|