C11H11BrN2S — CID 104777162
3-bromo-N-[(3-methylthiophen-2-yl)methyl]pyridin-4-amine (PubChem CID 104777162) has the molecular formula C11H11BrN2S and a molecular weight of 283.19 g/mol. Its IUPAC name is 3-bromo-N-[(3-methylthiophen-2-yl)methyl]pyridin-4-amine.
| Compound Name | 3-bromo-N-[(3-methylthiophen-2-yl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 104777162 |
| Molecular Formula | C11H11BrN2S |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 3-bromo-N-[(3-methylthiophen-2-yl)methyl]pyridin-4-amine |
| SMILES | Cc1ccsc1CNc1ccncc1Br |
| InChI | InChI=1S/C11H11BrN2S/c1-8-3-5-15-11(8)7-14-10-2-4-13-6-9(10)12/h2-6H,7H2,1H3,(H,13,14) |
| InChIKey | ZWKXDRKEMQZGLO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |