C15H15N3S — CID 103138732
8-N-[(3-methylthiophen-2-yl)methyl]isoquinoline-5,8-diamine (PubChem CID 103138732) has the molecular formula C15H15N3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 8-N-[(3-methylthiophen-2-yl)methyl]isoquinoline-5,8-diamine.
| Compound Name | 8-N-[(3-methylthiophen-2-yl)methyl]isoquinoline-5,8-diamine |
|---|---|
| PubChem CID | 103138732 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 8-N-[(3-methylthiophen-2-yl)methyl]isoquinoline-5,8-diamine |
| SMILES | Cc1ccsc1CNc1ccc(N)c2ccncc12 |
| InChI | InChI=1S/C15H15N3S/c1-10-5-7-19-15(10)9-18-14-3-2-13(16)11-4-6-17-8-12(11)14/h2-8,18H,9,16H2,1H3 |
| InChIKey | PCTXYFKJYDTQEG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|