C16H15FN2OS — CID 104780839
N-[3-(3-aminoprop-1-ynyl)-4-fluorophenyl]-5-ethylthiophene-2-carboxamide (PubChem CID 104780839) has the molecular formula C16H15FN2OS and a molecular weight of 302.37 g/mol. Its IUPAC name is N-[3-(3-aminoprop-1-ynyl)-4-fluorophenyl]-5-ethylthiophene-2-carboxamide.
| Compound Name | N-[3-(3-aminoprop-1-ynyl)-4-fluorophenyl]-5-ethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 104780839 |
| Molecular Formula | C16H15FN2OS |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-[3-(3-aminoprop-1-ynyl)-4-fluorophenyl]-5-ethylthiophene-2-carboxamide |
| SMILES | CCc1ccc(C(=O)Nc2ccc(F)c(C#CCN)c2)s1 |
| InChI | InChI=1S/C16H15FN2OS/c1-2-13-6-8-15(21-13)16(20)19-12-5-7-14(17)11(10-12)4-3-9-18/h5-8,10H,2,9,18H2,1H3,(H,19,20) |
| InChIKey | PIUMBZDETXSUGE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|