C14H13ClN4O — CID 104786959
2-chloro-6-(2,3,5-trimethylphenoxy)-7H-purine (PubChem CID 104786959) has the molecular formula C14H13ClN4O and a molecular weight of 288.74 g/mol. Its IUPAC name is 2-chloro-6-(2,3,5-trimethylphenoxy)-7H-purine.
| Compound Name | 2-chloro-6-(2,3,5-trimethylphenoxy)-7H-purine |
|---|---|
| PubChem CID | 104786959 |
| Molecular Formula | C14H13ClN4O |
| Molecular Weight | 288.74 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-chloro-6-(2,3,5-trimethylphenoxy)-7H-purine |
| SMILES | Cc1cc(C)c(C)c(Oc2nc(Cl)nc3nc[nH]c23)c1 |
| InChI | InChI=1S/C14H13ClN4O/c1-7-4-8(2)9(3)10(5-7)20-13-11-12(17-6-16-11)18-14(15)19-13/h4-6H,1-3H3,(H,16,17,18,19) |
| InChIKey | QTMBOGMXRDNXHO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.74 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |