C13H11ClN4O — CID 113453013
2-chloro-6-(3,4-dimethylphenoxy)-7H-purine (PubChem CID 113453013) has the molecular formula C13H11ClN4O and a molecular weight of 274.71 g/mol. Its IUPAC name is 2-chloro-6-(3,4-dimethylphenoxy)-7H-purine.
| Compound Name | 2-chloro-6-(3,4-dimethylphenoxy)-7H-purine |
|---|---|
| PubChem CID | 113453013 |
| Molecular Formula | C13H11ClN4O |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-chloro-6-(3,4-dimethylphenoxy)-7H-purine |
| SMILES | Cc1ccc(Oc2nc(Cl)nc3nc[nH]c23)cc1C |
| InChI | InChI=1S/C13H11ClN4O/c1-7-3-4-9(5-8(7)2)19-12-10-11(16-6-15-10)17-13(14)18-12/h3-6H,1-2H3,(H,15,16,17,18) |
| InChIKey | MNRNEKPZIXUBDP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |