C11H13N3O3 — CID 104788838
2-[3-(2-methylfuran-3-yl)-1,2,4-oxadiazol-5-yl]morpholine (PubChem CID 104788838) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-[3-(2-methylfuran-3-yl)-1,2,4-oxadiazol-5-yl]morpholine.
| Compound Name | 2-[3-(2-methylfuran-3-yl)-1,2,4-oxadiazol-5-yl]morpholine |
|---|---|
| PubChem CID | 104788838 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-[3-(2-methylfuran-3-yl)-1,2,4-oxadiazol-5-yl]morpholine |
| SMILES | Cc1occc1-c1noc(C2CNCCO2)n1 |
| InChI | InChI=1S/C11H13N3O3/c1-7-8(2-4-15-7)10-13-11(17-14-10)9-6-12-3-5-16-9/h2,4,9,12H,3,5-6H2,1H3 |
| InChIKey | ZOGWLPPUAMOVDQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |