C13H15N3O2 — CID 120833777
(2S)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]morpholine (PubChem CID 120833777) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is (2S)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]morpholine.
| Compound Name | (2S)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]morpholine |
|---|---|
| PubChem CID | 120833777 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (2S)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]morpholine |
| SMILES | Cc1ccc(-c2noc([C@@H]3CNCCO3)n2)cc1 |
| InChI | InChI=1S/C13H15N3O2/c1-9-2-4-10(5-3-9)12-15-13(18-16-12)11-8-14-6-7-17-11/h2-5,11,14H,6-8H2,1H3/t11-/m0/s1 |
| InChIKey | IUIRVVAYSHGRFE-NSHDSACASA-N |
| XLogP | 1.71 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |