C12H11Cl2N3O2 — CID 120836734
(2S)-2-[3-(2,6-dichlorophenyl)-1,2,4-oxadiazol-5-yl]morpholine (PubChem CID 120836734) has the molecular formula C12H11Cl2N3O2 and a molecular weight of 300.14 g/mol. Its IUPAC name is (2S)-2-[3-(2,6-dichlorophenyl)-1,2,4-oxadiazol-5-yl]morpholine.
| Compound Name | (2S)-2-[3-(2,6-dichlorophenyl)-1,2,4-oxadiazol-5-yl]morpholine |
|---|---|
| PubChem CID | 120836734 |
| Molecular Formula | C12H11Cl2N3O2 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | (2S)-2-[3-(2,6-dichlorophenyl)-1,2,4-oxadiazol-5-yl]morpholine |
| SMILES | Clc1cccc(Cl)c1-c1noc([C@@H]2CNCCO2)n1 |
| InChI | InChI=1S/C12H11Cl2N3O2/c13-7-2-1-3-8(14)10(7)11-16-12(19-17-11)9-6-15-4-5-18-9/h1-3,9,15H,4-6H2/t9-/m0/s1 |
| InChIKey | HPSHNYMNQJBXGT-VIFPVBQESA-N |
| XLogP | 2.70 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |