C18H29BrN2O7 — CID 10479607
[(2R,3S,5R)-5-[(5R,6R)-5-bromo-6-ethoxy-5-ethyl-2,4-dioxo-1,3-diazinan-1-yl]-3-hydroxyoxolan-2-yl]methyl pentanoate (PubChem CID 10479607) has the molecular formula C18H29BrN2O7 and a molecular weight of 465.34 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[(5R,6R)-5-bromo-6-ethoxy-5-ethyl-2,4-dioxo-1,3-diazinan-1-yl]-3-hydroxyoxolan-2-yl]methyl pentanoate.
| Compound Name | [(2R,3S,5R)-5-[(5R,6R)-5-bromo-6-ethoxy-5-ethyl-2,4-dioxo-1,3-diazinan-1-yl]-3-hydroxyoxolan-2-yl]methyl pentanoate |
|---|---|
| PubChem CID | 10479607 |
| Molecular Formula | C18H29BrN2O7 |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | [(2R,3S,5R)-5-[(5R,6R)-5-bromo-6-ethoxy-5-ethyl-2,4-dioxo-1,3-diazinan-1-yl]-3-hydroxyoxolan-2-yl]methyl pentanoate |
| SMILES | CCCCC(=O)OC[C@H]1O[C@@H](N2C(=O)NC(=O)[C@@](Br)(CC)[C@H]2OCC)C[C@@H]1O |
| InChI | InChI=1S/C18H29BrN2O7/c1-4-7-8-14(23)27-10-12-11(22)9-13(28-12)21-16(26-6-3)18(19,5-2)15(24)20-17(21)25/h11-13,16,22H,4-10H2,1-3H3,(H,20,24,25)/t11-,12+,13+,16+,18-/m0/s1 |
| InChIKey | DKVNGOHJGYDXML-CFURPYHBSA-N |
| XLogP | 1.65 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|