C20H32N4O7 — CID 158916627
[6-[[5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-3-hydroxyoxolan-2-yl]methoxy]oxan-2-yl]methyl hexanoate (PubChem CID 158916627) has the molecular formula C20H32N4O7 and a molecular weight of 440.50 g/mol. Its IUPAC name is [6-[[5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-3-hydroxyoxolan-2-yl]methoxy]oxan-2-yl]methyl hexanoate.
| Compound Name | [6-[[5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-3-hydroxyoxolan-2-yl]methoxy]oxan-2-yl]methyl hexanoate |
|---|---|
| PubChem CID | 158916627 |
| Molecular Formula | C20H32N4O7 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | [6-[[5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-3-hydroxyoxolan-2-yl]methoxy]oxan-2-yl]methyl hexanoate |
| SMILES | CCCCCC(=O)OCC1CCCC(OCC2OC(n3cnc(N)nc3=O)CC2O)O1 |
| InChI | InChI=1S/C20H32N4O7/c1-2-3-4-7-17(26)28-10-13-6-5-8-18(30-13)29-11-15-14(25)9-16(31-15)24-12-22-19(21)23-20(24)27/h12-16,18,25H,2-11H2,1H3,(H2,21,23,27) |
| InChIKey | DHYNLTRZRPJGON-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 148.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|