C17H30N4O4Si — CID 150129352
4-amino-1-[(2R,4S,5R)-5-[[cyclopentyl(diethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-1,3,5-triazin-2-one (PubChem CID 150129352) has the molecular formula C17H30N4O4Si and a molecular weight of 382.54 g/mol. Its IUPAC name is 4-amino-1-[(2R,4S,5R)-5-[[cyclopentyl(diethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-1,3,5-triazin-2-one.
| Compound Name | 4-amino-1-[(2R,4S,5R)-5-[[cyclopentyl(diethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 150129352 |
| Molecular Formula | C17H30N4O4Si |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 4-amino-1-[(2R,4S,5R)-5-[[cyclopentyl(diethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-1,3,5-triazin-2-one |
| SMILES | CC[Si](CC)(OC[C@H]1O[C@@H](n2cnc(N)nc2=O)C[C@@H]1O)C1CCCC1 |
| InChI | InChI=1S/C17H30N4O4Si/c1-3-26(4-2,12-7-5-6-8-12)24-10-14-13(22)9-15(25-14)21-11-19-16(18)20-17(21)23/h11-15,22H,3-10H2,1-2H3,(H2,18,20,23)/t13-,14+,15+/m0/s1 |
| InChIKey | FAXGESOKOCFVNA-RRFJBIMHSA-N |
| XLogP | 1.82 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|