C11H18BrN3O5 — CID 18401422
1-[4-amino-5-(hydroxymethyl)oxolan-2-yl]-5-bromo-6-methoxy-5-methyl-1,3-diazinane-2,4-dione (PubChem CID 18401422) has the molecular formula C11H18BrN3O5 and a molecular weight of 352.19 g/mol. Its IUPAC name is 1-[4-amino-5-(hydroxymethyl)oxolan-2-yl]-5-bromo-6-methoxy-5-methyl-1,3-diazinane-2,4-dione.
| Compound Name | 1-[4-amino-5-(hydroxymethyl)oxolan-2-yl]-5-bromo-6-methoxy-5-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 18401422 |
| Molecular Formula | C11H18BrN3O5 |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 1-[4-amino-5-(hydroxymethyl)oxolan-2-yl]-5-bromo-6-methoxy-5-methyl-1,3-diazinane-2,4-dione |
| SMILES | COC1N(C2CC(N)C(CO)O2)C(=O)NC(=O)C1(C)Br |
| InChI | InChI=1S/C11H18BrN3O5/c1-11(12)8(17)14-10(18)15(9(11)19-2)7-3-5(13)6(4-16)20-7/h5-7,9,16H,3-4,13H2,1-2H3,(H,14,17,18) |
| InChIKey | GNEVPQMLPYMUPG-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|