C10H13BrFN5O4 — CID 56606808
(5S,6S)-6-azido-5-bromo-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-1,3-diazinane-2,4-dione (PubChem CID 56606808) has the molecular formula C10H13BrFN5O4 and a molecular weight of 366.15 g/mol. Its IUPAC name is (5S,6S)-6-azido-5-bromo-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-1,3-diazinane-2,4-dione.
| Compound Name | (5S,6S)-6-azido-5-bromo-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 56606808 |
| Molecular Formula | C10H13BrFN5O4 |
| Molecular Weight | 366.15 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | (5S,6S)-6-azido-5-bromo-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-1,3-diazinane-2,4-dione |
| SMILES | C[C@@]1(Br)C(=O)NC(=O)N([C@H]2C[C@H](F)[C@@H](CO)O2)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C10H13BrFN5O4/c1-10(11)7(15-16-13)17(9(20)14-8(10)19)6-2-4(12)5(3-18)21-6/h4-7,18H,2-3H2,1H3,(H,14,19,20)/t4-,5+,6+,7+,10-/m0/s1 |
| InChIKey | IDWBYDBXZDJTCY-BLICNDNGSA-N |
| XLogP | 0.77 |
| TPSA | 127.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.15 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|