C12H16FN5O6 — CID 91352794
[3-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-5-methyl-2,6-dioxo-1,3-diazinan-4-yl] acetate (PubChem CID 91352794) has the molecular formula C12H16FN5O6 and a molecular weight of 345.29 g/mol. Its IUPAC name is [3-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-5-methyl-2,6-dioxo-1,3-diazinan-4-yl] acetate.
| Compound Name | [3-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-5-methyl-2,6-dioxo-1,3-diazinan-4-yl] acetate |
|---|---|
| PubChem CID | 91352794 |
| Molecular Formula | C12H16FN5O6 |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | [3-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-5-methyl-2,6-dioxo-1,3-diazinan-4-yl] acetate |
| SMILES | CC(=O)OC1N([C@H]2C[C@H](N=[N+]=[N-])[C@@H](CO)O2)C(=O)NC(=O)C1(C)F |
| InChI | InChI=1S/C12H16FN5O6/c1-5(20)23-10-12(2,13)9(21)15-11(22)18(10)8-3-6(16-17-14)7(4-19)24-8/h6-8,10,19H,3-4H2,1-2H3,(H,15,21,22)/t6-,7+,8+,10?,12?/m0/s1 |
| InChIKey | APQRGMLQPORFPQ-IDPSTWFOSA-N |
| XLogP | -0.06 |
| TPSA | 153.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|