C13H19N5O6 — CID 21121368
2-[1-[(2R,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-2,4-dioxo-1,3-diazinan-5-yl]propanoic acid (PubChem CID 21121368) has the molecular formula C13H19N5O6 and a molecular weight of 341.32 g/mol. Its IUPAC name is 2-[1-[(2R,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-2,4-dioxo-1,3-diazinan-5-yl]propanoic acid.
| Compound Name | 2-[1-[(2R,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-2,4-dioxo-1,3-diazinan-5-yl]propanoic acid |
|---|---|
| PubChem CID | 21121368 |
| Molecular Formula | C13H19N5O6 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-[1-[(2R,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-2,4-dioxo-1,3-diazinan-5-yl]propanoic acid |
| SMILES | CC(C(=O)O)C1(C)CN([C@H]2CC(N=[N+]=[N-])[C@@H](CO)O2)C(=O)NC1=O |
| InChI | InChI=1S/C13H19N5O6/c1-6(10(20)21)13(2)5-18(12(23)15-11(13)22)9-3-7(16-17-14)8(4-19)24-9/h6-9,19H,3-5H2,1-2H3,(H,20,21)(H,15,22,23)/t6?,7?,8-,9-,13?/m1/s1 |
| InChIKey | UPQBABJYEVIOKT-UWDHQAPTSA-N |
| XLogP | 0.05 |
| TPSA | 164.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|