C17H27N6O7PS — CID 22898373
methyl 2-[[[3-azido-5-(5,5,6-trimethyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methoxy-methanethioylphosphoryl]amino]propanoate (PubChem CID 22898373) has the molecular formula C17H27N6O7PS and a molecular weight of 490.48 g/mol. Its IUPAC name is methyl 2-[[[3-azido-5-(5,5,6-trimethyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methoxy-methanethioylphosphoryl]amino]propanoate.
| Compound Name | methyl 2-[[[3-azido-5-(5,5,6-trimethyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methoxy-methanethioylphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 22898373 |
| Molecular Formula | C17H27N6O7PS |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | methyl 2-[[[3-azido-5-(5,5,6-trimethyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methoxy-methanethioylphosphoryl]amino]propanoate |
| SMILES | COC(=O)C(C)NP(=O)(C=S)OCC1OC(N2C(=O)NC(=O)C(C)(C)C2C)CC1N=[N+]=[N-] |
| InChI | InChI=1S/C17H27N6O7PS/c1-9(14(24)28-5)21-31(27,8-32)29-7-12-11(20-22-18)6-13(30-12)23-10(2)17(3,4)15(25)19-16(23)26/h8-13H,6-7H2,1-5H3,(H,21,27)(H,19,25,26) |
| InChIKey | WRFXIIZWEBDBPT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 172.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|