C23H31N6O8P — CID 22898370
methyl 2-[[[3-azido-5-(5,5,6-trimethyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methoxy-formylphosphoryl]amino]-3-phenylpropanoate (PubChem CID 22898370) has the molecular formula C23H31N6O8P and a molecular weight of 550.51 g/mol. Its IUPAC name is methyl 2-[[[3-azido-5-(5,5,6-trimethyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methoxy-formylphosphoryl]amino]-3-phenylpropanoate.
| Compound Name | methyl 2-[[[3-azido-5-(5,5,6-trimethyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methoxy-formylphosphoryl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 22898370 |
| Molecular Formula | C23H31N6O8P |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | methyl 2-[[[3-azido-5-(5,5,6-trimethyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methoxy-formylphosphoryl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NP(=O)(C=O)OCC1OC(N2C(=O)NC(=O)C(C)(C)C2C)CC1N=[N+]=[N-] |
| InChI | InChI=1S/C23H31N6O8P/c1-14-23(2,3)21(32)25-22(33)29(14)19-11-16(26-28-24)18(37-19)12-36-38(34,13-30)27-17(20(31)35-4)10-15-8-6-5-7-9-15/h5-9,13-14,16-19H,10-12H2,1-4H3,(H,27,34)(H,25,32,33) |
| InChIKey | HASHOTQYOSZZGO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 189.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|