C11H16ClFN2O5 — CID 67177164
5-chloro-6-ethoxy-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2,4-dione (PubChem CID 67177164) has the molecular formula C11H16ClFN2O5 and a molecular weight of 310.71 g/mol. Its IUPAC name is 5-chloro-6-ethoxy-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2,4-dione.
| Compound Name | 5-chloro-6-ethoxy-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 67177164 |
| Molecular Formula | C11H16ClFN2O5 |
| Molecular Weight | 310.71 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 5-chloro-6-ethoxy-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2,4-dione |
| SMILES | CCOC1C(Cl)C(=O)NC(=O)N1[C@H]1C[C@H](F)[C@@H](CO)O1 |
| InChI | InChI=1S/C11H16ClFN2O5/c1-2-19-10-8(12)9(17)14-11(18)15(10)7-3-5(13)6(4-16)20-7/h5-8,10,16H,2-4H2,1H3,(H,14,17,18)/t5-,6+,7+,8?,10?/m0/s1 |
| InChIKey | DYFDJVUJBSMJHR-IIZZPTMTSA-N |
| XLogP | -0.05 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.71 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|