C24H32Cl2N2O3 — CID 10479701
2-(4-tert-butyl-2-chlorophenoxy)-N-[3-chloro-4-[2-(diethylamino)ethoxy]phenyl]acetamide (PubChem CID 10479701) has the molecular formula C24H32Cl2N2O3 and a molecular weight of 467.44 g/mol. Its IUPAC name is 2-(4-tert-butyl-2-chlorophenoxy)-N-[3-chloro-4-[2-(diethylamino)ethoxy]phenyl]acetamide.
| Compound Name | 2-(4-tert-butyl-2-chlorophenoxy)-N-[3-chloro-4-[2-(diethylamino)ethoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 10479701 |
| Molecular Formula | C24H32Cl2N2O3 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 2-(4-tert-butyl-2-chlorophenoxy)-N-[3-chloro-4-[2-(diethylamino)ethoxy]phenyl]acetamide |
| SMILES | CCN(CC)CCOc1ccc(NC(=O)COc2ccc(C(C)(C)C)cc2Cl)cc1Cl |
| InChI | InChI=1S/C24H32Cl2N2O3/c1-6-28(7-2)12-13-30-21-11-9-18(15-20(21)26)27-23(29)16-31-22-10-8-17(14-19(22)25)24(3,4)5/h8-11,14-15H,6-7,12-13,16H2,1-5H3,(H,27,29) |
| InChIKey | ZLQMSXRGKZMTGN-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |