C21H25ClF3N3O3 — CID 59691580
N-[3-amino-4-[2-(diethylamino)ethoxy]phenyl]-2-[2-chloro-4-(trifluoromethyl)phenoxy]acetamide (PubChem CID 59691580) has the molecular formula C21H25ClF3N3O3 and a molecular weight of 459.90 g/mol. Its IUPAC name is N-[3-amino-4-[2-(diethylamino)ethoxy]phenyl]-2-[2-chloro-4-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[3-amino-4-[2-(diethylamino)ethoxy]phenyl]-2-[2-chloro-4-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 59691580 |
| Molecular Formula | C21H25ClF3N3O3 |
| Molecular Weight | 459.90 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | N-[3-amino-4-[2-(diethylamino)ethoxy]phenyl]-2-[2-chloro-4-(trifluoromethyl)phenoxy]acetamide |
| SMILES | CCN(CC)CCOc1ccc(NC(=O)COc2ccc(C(F)(F)F)cc2Cl)cc1N |
| InChI | InChI=1S/C21H25ClF3N3O3/c1-3-28(4-2)9-10-30-19-8-6-15(12-17(19)26)27-20(29)13-31-18-7-5-14(11-16(18)22)21(23,24)25/h5-8,11-12H,3-4,9-10,13,26H2,1-2H3,(H,27,29) |
| InChIKey | LSFVKYYBGLLMJN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.90 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|