C23H26ClF3N2O4 — CID 70967829
ethyl 5-[[2-chloro-4-(trifluoromethyl)benzoyl]amino]-2-[2-(diethylamino)ethoxy]benzoate (PubChem CID 70967829) has the molecular formula C23H26ClF3N2O4 and a molecular weight of 486.92 g/mol. Its IUPAC name is ethyl 5-[[2-chloro-4-(trifluoromethyl)benzoyl]amino]-2-[2-(diethylamino)ethoxy]benzoate.
| Compound Name | ethyl 5-[[2-chloro-4-(trifluoromethyl)benzoyl]amino]-2-[2-(diethylamino)ethoxy]benzoate |
|---|---|
| PubChem CID | 70967829 |
| Molecular Formula | C23H26ClF3N2O4 |
| Molecular Weight | 486.92 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | ethyl 5-[[2-chloro-4-(trifluoromethyl)benzoyl]amino]-2-[2-(diethylamino)ethoxy]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)c2ccc(C(F)(F)F)cc2Cl)ccc1OCCN(CC)CC |
| InChI | InChI=1S/C23H26ClF3N2O4/c1-4-29(5-2)11-12-33-20-10-8-16(14-18(20)22(31)32-6-3)28-21(30)17-9-7-15(13-19(17)24)23(25,26)27/h7-10,13-14H,4-6,11-12H2,1-3H3,(H,28,30) |
| InChIKey | CWSUVXFCYLNWLC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.92 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |