C17H13BrCl2F3NO — CID 89282724
N-[4-(3-bromopropyl)-3-chlorophenyl]-2-chloro-4-(trifluoromethyl)benzamide (PubChem CID 89282724) has the molecular formula C17H13BrCl2F3NO and a molecular weight of 455.10 g/mol. Its IUPAC name is N-[4-(3-bromopropyl)-3-chlorophenyl]-2-chloro-4-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(3-bromopropyl)-3-chlorophenyl]-2-chloro-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 89282724 |
| Molecular Formula | C17H13BrCl2F3NO |
| Molecular Weight | 455.10 g/mol |
| Exact Mass | 452.95 |
| IUPAC Name | N-[4-(3-bromopropyl)-3-chlorophenyl]-2-chloro-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccc(CCCBr)c(Cl)c1)c1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C17H13BrCl2F3NO/c18-7-1-2-10-3-5-12(9-14(10)19)24-16(25)13-6-4-11(8-15(13)20)17(21,22)23/h3-6,8-9H,1-2,7H2,(H,24,25) |
| InChIKey | PNGZCUOVVWWYIP-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.10 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|