C24H26Cl2F2N2O2 — CID 162579691
3-[2-chloro-4-(1,1-difluoroprop-2-enyl)phenyl]-N-[3-chloro-4-[2-[ethenyl(ethyl)amino]ethoxy]phenyl]propanamide (PubChem CID 162579691) has the molecular formula C24H26Cl2F2N2O2 and a molecular weight of 483.39 g/mol. Its IUPAC name is 3-[2-chloro-4-(1,1-difluoroprop-2-enyl)phenyl]-N-[3-chloro-4-[2-[ethenyl(ethyl)amino]ethoxy]phenyl]propanamide.
| Compound Name | 3-[2-chloro-4-(1,1-difluoroprop-2-enyl)phenyl]-N-[3-chloro-4-[2-[ethenyl(ethyl)amino]ethoxy]phenyl]propanamide |
|---|---|
| PubChem CID | 162579691 |
| Molecular Formula | C24H26Cl2F2N2O2 |
| Molecular Weight | 483.39 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 3-[2-chloro-4-(1,1-difluoroprop-2-enyl)phenyl]-N-[3-chloro-4-[2-[ethenyl(ethyl)amino]ethoxy]phenyl]propanamide |
| SMILES | C=CN(CC)CCOc1ccc(NC(=O)CCc2ccc(C(F)(F)C=C)cc2Cl)cc1Cl |
| InChI | InChI=1S/C24H26Cl2F2N2O2/c1-4-24(27,28)18-9-7-17(20(25)15-18)8-12-23(31)29-19-10-11-22(21(26)16-19)32-14-13-30(5-2)6-3/h4-5,7,9-11,15-16H,1-2,6,8,12-14H2,3H3,(H,29,31) |
| InChIKey | RCJMTVKFVUZDQX-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.39 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|