C20H16F4N4O3S — CID 10479737
N-[5-(2-fluorophenyl)-6-(4-methylsulfonylphenyl)-2-(trifluoromethyl)pyrimidin-4-yl]acetohydrazide (PubChem CID 10479737) has the molecular formula C20H16F4N4O3S and a molecular weight of 468.43 g/mol. Its IUPAC name is N-[5-(2-fluorophenyl)-6-(4-methylsulfonylphenyl)-2-(trifluoromethyl)pyrimidin-4-yl]acetohydrazide.
| Compound Name | N-[5-(2-fluorophenyl)-6-(4-methylsulfonylphenyl)-2-(trifluoromethyl)pyrimidin-4-yl]acetohydrazide |
|---|---|
| PubChem CID | 10479737 |
| Molecular Formula | C20H16F4N4O3S |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | N-[5-(2-fluorophenyl)-6-(4-methylsulfonylphenyl)-2-(trifluoromethyl)pyrimidin-4-yl]acetohydrazide |
| SMILES | CC(=O)N(N)c1nc(C(F)(F)F)nc(-c2ccc(S(C)(=O)=O)cc2)c1-c1ccccc1F |
| InChI | InChI=1S/C20H16F4N4O3S/c1-11(29)28(25)18-16(14-5-3-4-6-15(14)21)17(26-19(27-18)20(22,23)24)12-7-9-13(10-8-12)32(2,30)31/h3-10H,25H2,1-2H3 |
| InChIKey | KISZPZXSVWXAAL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|