C21H17ClF3N2O5S2- — CID 154084500
3-chloro-1-[6-(4-methylsulfonylphenyl)-5-phenyl-2-(trifluoromethyl)pyrimidin-4-yl]propane-1-sulfonate (PubChem CID 154084500) has the molecular formula C21H17ClF3N2O5S2- and a molecular weight of 533.96 g/mol. Its IUPAC name is 3-chloro-1-[6-(4-methylsulfonylphenyl)-5-phenyl-2-(trifluoromethyl)pyrimidin-4-yl]propane-1-sulfonate.
| Compound Name | 3-chloro-1-[6-(4-methylsulfonylphenyl)-5-phenyl-2-(trifluoromethyl)pyrimidin-4-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 154084500 |
| Molecular Formula | C21H17ClF3N2O5S2- |
| Molecular Weight | 533.96 g/mol |
| Exact Mass | 533.02 |
| IUPAC Name | 3-chloro-1-[6-(4-methylsulfonylphenyl)-5-phenyl-2-(trifluoromethyl)pyrimidin-4-yl]propane-1-sulfonate |
| SMILES | CS(=O)(=O)c1ccc(-c2nc(C(F)(F)F)nc(C(CCCl)S(=O)(=O)[O-])c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H18ClF3N2O5S2/c1-33(28,29)15-9-7-14(8-10-15)18-17(13-5-3-2-4-6-13)19(16(11-12-22)34(30,31)32)27-20(26-18)21(23,24)25/h2-10,16H,11-12H2,1H3,(H,30,31,32)/p-1 |
| InChIKey | DUKYCIKXLIZRDU-UHFFFAOYSA-M |
| XLogP | 4.45 |
| TPSA | 117.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.96 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|