C18H15F3N4O2S — CID 10319265
[6-(4-methylsulfonylphenyl)-5-phenyl-2-(trifluoromethyl)pyrimidin-4-yl]hydrazine (PubChem CID 10319265) has the molecular formula C18H15F3N4O2S and a molecular weight of 408.41 g/mol. Its IUPAC name is [6-(4-methylsulfonylphenyl)-5-phenyl-2-(trifluoromethyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [6-(4-methylsulfonylphenyl)-5-phenyl-2-(trifluoromethyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 10319265 |
| Molecular Formula | C18H15F3N4O2S |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | [6-(4-methylsulfonylphenyl)-5-phenyl-2-(trifluoromethyl)pyrimidin-4-yl]hydrazine |
| SMILES | CS(=O)(=O)c1ccc(-c2nc(C(F)(F)F)nc(NN)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15F3N4O2S/c1-28(26,27)13-9-7-12(8-10-13)15-14(11-5-3-2-4-6-11)16(25-22)24-17(23-15)18(19,20)21/h2-10H,22H2,1H3,(H,23,24,25) |
| InChIKey | LYQBEZGFPZWTCJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|