C18H11F6N5O — CID 24957539
2,2,2-trifluoro-N'-[5-phenyl-6-pyridin-4-yl-2-(trifluoromethyl)pyrimidin-4-yl]acetohydrazide (PubChem CID 24957539) has the molecular formula C18H11F6N5O and a molecular weight of 427.31 g/mol. Its IUPAC name is 2,2,2-trifluoro-N'-[5-phenyl-6-pyridin-4-yl-2-(trifluoromethyl)pyrimidin-4-yl]acetohydrazide.
| Compound Name | 2,2,2-trifluoro-N'-[5-phenyl-6-pyridin-4-yl-2-(trifluoromethyl)pyrimidin-4-yl]acetohydrazide |
|---|---|
| PubChem CID | 24957539 |
| Molecular Formula | C18H11F6N5O |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 2,2,2-trifluoro-N'-[5-phenyl-6-pyridin-4-yl-2-(trifluoromethyl)pyrimidin-4-yl]acetohydrazide |
| SMILES | O=C(NNc1nc(C(F)(F)F)nc(-c2ccncc2)c1-c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H11F6N5O/c19-17(20,21)15-26-13(11-6-8-25-9-7-11)12(10-4-2-1-3-5-10)14(27-15)28-29-16(30)18(22,23)24/h1-9H,(H,29,30)(H,26,27,28) |
| InChIKey | JYDQPOUCKILMQW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|